| Identification | |
| Name: | Benzeneethanol,2-bromo- |
| Synonyms: | Phenethylalcohol, o-bromo- (7CI,8CI);2-(2-Hydroxyethyl)bromobenzene;2-Bromobenzeneethanol;2-Bromophenethyl alcohol;o-Bromophenethyl alcohol;o-Bromophenylethyl alcohol; |
| CAS: | 1074-16-4 |
| Molecular Formula: | C8H9BrO |
| Molecular Weight: | 201.06 |
| InChI: | InChI=1/C8H9BrO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.7°C |
| Density: | 1.483 |
| Refractive index: | 1.577 |
| Appearance: | clear slightly yellow liquid |
| Specification: |
The 2-(2-Bromophenyl)ethanol with the cas number 1074-16-4 is also called Benzeneethanol,2-bromo-. Its molecular formula is C8H9BrO. belongs to the following product categories: (1)blocks; (2)Bromides; (3)Alcohols; (4)C7 to C8; (5)Oxygen Compounds. It is clear slightly yellow liquid. The properties of the chemical are: (1)ACD/LogP: 2.13; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.13; (4)ACD/LogD (pH 7.4): 2.13; (5)ACD/BCF (pH 5.5): 24.51; (6)ACD/BCF (pH 7.4): 24.51; (7)ACD/KOC (pH 5.5): 343.65; (8)ACD/KOC (pH 7.4): 343.65; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 9.23 Å2; (13)Index of Refraction: 1.576; (14)Molar Refractivity: 45.02 cm3; (15)Molar Volume: 135.9 cm3; (16)Polarizability: 17.85×10-24cm3; (17)Surface Tension: 44.4 dyne/cm ; (18)Enthalpy of Vaporization: 53.61 kJ/mol; (19)Vapour Pressure: 0.0036 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 116.7°C |
| Safety Data | |
 |
|
