| Identification | |
| Name: | 4-mercaptobenzoic acid |
| Synonyms: | Mercaptobenzoicacid; 95% |
| CAS: | 1074-36-8 |
| EINECS: | 205-704-3 |
| Molecular Formula: | C7H6O2S |
| Molecular Weight: | 154.19 |
| InChI: | InChI=1/C7H6O2S/c8-7(9)5-1-3-6(10)4-2-5/h1-4,10H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 143.9 oC |
| Boiling Point: | 314.3oC at 760 mmHg |
| Density: | 1.345 g/cm3 |
| Solubility: | Insoluble (soluble in alcohol and ether) |
| Appearance: | white to pale yellow powder |
| Flash Point: | 143.9 oC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
