| Identification | |
| Name: | Indole-7-carboxaldehyde |
| Synonyms: | Indole-7-carboxaldehyde(7CI,8CI);7-Formylindole;1H-Indole-7-carboxaldehyde; |
| CAS: | 1074-88-0 |
| Molecular Formula: | C9H7NO |
| Molecular Weight: | 145.16 |
| InChI: | InChI=1/C9H7NO/c11-6-8-3-1-2-7-4-5-10-9(7)8/h1-6,10H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.278 g/cm3 |
| Refractive index: | 1.729 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Yellow Crystalline Solid |
| Specification: |
Indole-7-carboxaldehyde (1074-88-0) is sensitive to air and light. It is incompatibilities with strong oxidizing agents and bases. It emits nitrogen oxides, carbon monoxide and carbon dioxideit when it is decomposed. |
| Storage Temperature: | Keep Cold |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
