| Identification | |
| Name: | Benzenepropanal,2-bromo- |
| Synonyms: | 2-Bromobenzenepropanal;3-(2-Bromophenyl)propanal;3-(2-Bromophenyl)propionaldehyde; |
| CAS: | 107408-16-2 |
| Molecular Formula: | C9H9BrO |
| Molecular Weight: | 213.07116 |
| InChI: | InChI=1/C9H9BrO/c10-9-6-2-1-4-8(9)5-3-7-11/h1-2,4,6-7H,3,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.399 g/cm3 |
| Refractive index: | 1.547 |
| Specification: |
The 3-(2-Bromophenyl)propionaldehyde, with the CAS registry number 107408-16-2, is also known as Benzenepropanal, 2-bromo-. This chemical's molecular formula is C9H9BrO and molecular weight is 213.07. Its systematic name is called 3-(2-bromophenyl)propanal. Physical properties of 3-(2-Bromophenyl)propionaldehyde: (1)ACD/LogP: 2.55; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 80; (6)ACD/BCF (pH 7.4): 80; (7)ACD/KOC (pH 5.5): 802; (8)ACD/KOC (pH 7.4): 802; (9)#H bond acceptors: 1; (10)#Freely Rotating Bonds: 3; (11)Index of Refraction: 1.547; (12)Molar Refractivity: 48.312 cm3; (13)Molar Volume: 152.261 cm3; (14)Surface Tension: 40.048 dyne/cm; (15)Density: 1.399 g/cm3; (16)Flash Point: 73.92 °C; (17)Enthalpy of Vaporization: 50.079 kJ/mol; (18)Boiling Point: 262.983 °C at 760 mmHg; (19)Vapour Pressure: 0.011 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
