| Identification | |
| Name: | 3,3-Tetramethyleneglutarimide |
| Synonyms: | 1,1-Cyclopentanediacetimide(6CI,7CI,8CI);8-Azaspiro[4.5]decane-7,9-dione;3-Spirocyclopentaneglutarimide;4,4-Tetramethyleneglutarimide;NSC 400092;b-Spirocyclopentaneglutarimide; |
| CAS: | 1075-89-4 |
| EINECS: | 427-770-4 |
| Molecular Formula: | C9H13NO2 |
| Molecular Weight: | 167.21 |
| InChI: | InChI=1/C9H13NO2/c11-7-5-9(3-1-2-4-9)6-8(12)10-7/h1-6H2,(H,10,11,12) |
| Molecular Structure: | ![(C9H13NO2) 1,1-Cyclopentanediacetimide(6CI,7CI,8CI);8-Azaspiro[4.5]decane-7,9-dione;3-Spirocyclopentaneglutarim...](https://img.guidechem.com/casimg/1075-89-4.gif) |
| Properties | |
| Density: | 1.17 g/cm3 |
| Refractive index: | 1.523 |
| Appearance: | white to off-white crystalline powder |
| Specification: |
3,3-Tetramethyleneglutarimide , its cas register number is 1075-89-4. It also can be called 8-Azaspiro[4,5]decane-7,9-dione .It is a white to off-white crystalline powder. |
| Storage Temperature: | Poison room |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
