| Identification | |
| Name: | Terephthalic acid, hexahydro- |
| Synonyms: | Acide cyclohexane-1,4-dicarboxylique;Cyclohexane-1,4-dicarboxylic acid;Hexahydroterephthalic acid;1,4-Dicarboxycyclohexane;CHDA;UNII-13LBH83IU4; |
| CAS: | 1076-97-7 |
| EINECS: | 214-068-6 |
| Molecular Formula: | C8H12O4 |
| Molecular Weight: | 172.18 |
| InChI: | InChI=1/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.314 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.457 |
| Water Solubility: | SOLUBLE |
| Solubility: | SOLUBLE IN WATER |
| Appearance: | White Crystal |
| Specification: |
? 1,4-Cyclohexanedicarboxylicacid ,?its cas register number is 1076-97-7. It also can be called?1,4-Dicarboxycyclohexane ; |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
