| Identification | |
| Name: | 1,4-Benzenedicarbothioicacid |
| Synonyms: | Terephthalicacid, 1,4-dithio- (7CI,8CI); 1,4-Dithioterephthalic acid; Dithioterephthalicacid; NSC 38771 |
| CAS: | 1076-98-8 |
| EINECS: | 214-069-1 |
| Molecular Formula: | C8H6 O2 S2 |
| Molecular Weight: | 198.26 |
| InChI: | InChI=1/C8H6O2S2/c9-7(11)5-1-2-6(4-3-5)8(10)12/h1-4H,(H,9,11)(H,10,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 174.9°C |
| Boiling Point: | 365.6°Cat760mmHg |
| Density: | 1.343g/cm3 |
| Refractive index: | 1.634 |
| Specification: |
Dithioterephthalic acid , its cas register number is 1076-98-8. It also can be called 1,4-Benzenedicarbothioic acid ; Terephthalic acid, 1,4-dithio- ; Dithioloterephthalic acid ; and 1,4-Benzenebis(carbothioic acid) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 174.9°C |
| Safety Data | |
 |
|
