| Identification | |
| Name: | 1H-Imidazole-1-propanol,2-methyl-5-nitro- |
| Synonyms: | Imidazole-1-propanol,2-methyl-5-nitro- (6CI,7CI,8CI);1-(3-Hydroxypropyl)-2-methyl-5-nitroimidazole;Ternidazole;3-(2-Methyl-5-nitroimidazol-1-yl)propan-1-ol; |
| CAS: | 1077-93-6 |
| EINECS: | 214-077-5 |
| Molecular Formula: | C7H11N3O3 |
| Molecular Weight: | 185.18 |
| InChI: | InChI=1/C7H11N3O3/c1-6-8-5-7(10(12)13)9(6)3-2-4-11/h5,11H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.38 g/cm3 |
| Refractive index: | 1.595 |
| Specification: |
The CAS register number of Ternidazole is 1077-93-6. It also can be called as 2-Methyl-5-nitroimidazole-1-propanol and the IUPAC name about this chemical is 3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol. The molecular formula about this chemical is C7H11N3O3 and the molecular weight is 185.18. Physical properties about Ternidazole are: (1)ACD/LogP: -0.10; (2)ACD/LogD (pH 5.5): -0.1; (3)ACD/LogD (pH 7.4): -0.1; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 20.88; (7)ACD/KOC (pH 7.4): 20.92; (8)#H bond acceptors: 6; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 5; (11)Polar Surface Area: 72.87Å2; (12)Index of Refraction: 1.595; (13)Molar Refractivity: 45.59 cm3; (14)Molar Volume: 134 cm3; (15)Polarizability: 18.07x10-24cm3; (16)Surface Tension: 56.4 dyne/cm; (17)Enthalpy of Vaporization: 71.03 kJ/mol; (18)Boiling Point: 419.9 °C at 760 mmHg; (19)Vapour Pressure: 8.4E-08 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
