| Identification | |
| Synonyms: | MDL 11939; |
| CAS: | 107703-78-6 |
| Molecular Formula: | C20H25NO |
| Molecular Weight: | 376.19 |
| InChI: | InChI=1/C20H25NO/c22-20(18-9-5-2-6-10-18)19-12-15-21(16-13-19)14-11-17-7-3-1-4-8-17/h1-10,19-20,22H,11-16H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 205.6°C |
| Boiling Point: | 434.2°Cat760mmHg |
| Density: | 1.084g/cm3 |
| Biological Activity: | Potent, selective and orally active 5-HT 2 receptor antagonist (K i values are 0.54 and 81.6 nM at 5-HT 2A and 5-HT 2C receptors respectively). |
| Flash Point: | 205.6°C |
| Safety Data | |
 |
|
