| Identification |
| Name: | Chlorodiphenylphosphine |
| Synonyms: | Diphenyl chlorophosphine~Diphenylphosphinous chloride; Diphenylphosphinous Chloride; Diphenylchlorophosphine; DPC; diphenylphosphine Chloride |
| CAS: | 1079-66-9 |
| EINECS: | 214-093-2 |
| Molecular Formula: | C12H10ClP |
| Molecular Weight: | 220.64 |
| InChI: | InChI=1/C12H10ClP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Melting Point: | 14 - 16 C |
| Density: | 1.229 |
| Stability: | Stable under normal temperatures and pressures. Combines vigorously or explosively with water. |
| Refractive index: | 1.634-1.637 |
| Water Solubility: | Reacts violently |
| Solubility: | Violently reacts | |
| Appearance: | clear to yellow liquid |
| Packinggroup: | II |
| HS Code: | 29310095 |
| Storage Temperature: | Store at R.T. |
| Sensitive: | Air & Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
