| Identification | |
| Name: | N,N-Dimethylethanolamine |
| Synonyms: | 2-(Dimethylamino)ethanol; Deanol; 2-Dimethylamine Ethanol; (CH3)2NCH2CH2OH; 2-(Dimethylamine)ethanol; 2-(Dimethylamino)-1-ethanol; 2-(dimethylamino)-ethano; 2-dimethylamino-ethano; 2-dwumetyloaminoetanolu; Amietol M 21; amietolm21; DMEA; Dimethylaminoethanol; 2-(Dimethylamino)ethanol; beta-(Dimethylamino)ethanol; 2-(Dimethylamino)ethyl alcohol; Dimethy(hydroxyethl)amine; 2-(N,N-Dimethylamino)ethanol; Dimethylethanolamine; Dimethyl(2-hydroxyethyl)amine; N,N-Dimethylethanolamine; N,N-Dimethyl(2-hydroxyethyl)amine; N,N-Dimethyl-beta-hydroxyethylamine; N,N-Dimethyl-N-(beta-hydroxyethyl)amine; Norcholine |
| CAS: | 108-01-0 |
| EINECS: | 203-542-8 |
| Molecular Formula: | C4H11NO |
| Molecular Weight: | 89.14 |
| InChI: | InChI=1/C4H11NO/c1-5(2)3-4-6/h6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2051 |
| Density: | 0.888 |
| Stability: | Stable. Flammable. Incompatible with oxidizing agents, copper, copper alloys, zinc, acids, galvanised iron. Hygroscopic. |
| Refractive index: | 1.429-1.43 |
| Water Solubility: | miscible |
| Solubility: | miscible in water |
| Appearance: | clear to pale yellow liquid |
| Specification: |
? N,N-Dimethylethanolamine , with CAS number of 108-01-0, can be called (2-Hydroxyethyl)dimethylamine ; (N,N-Dimethylamino)ethanol ; (Dimethylamino)ethanol ; 2-(Dimethylamino)ethyl alcohol ; Aminoalcohol 2mabs ; Dimethyl(2-hydroxyethyl)amine ; Jeffcat DMEA ; N-(2-Hydroxyethyl)-N,N-dimethylamine ; N,N-Dimethyl-b-hydroxyethylamine . It is a?colourless liquid, it?is an aminoalcohol. Amines are chemical bases. They neutralize acids to form salts plus water. These acid-base reactions are exothermic. The amount of heat that is evolved per mole of amine in a neutralization is largely independent of the strength of the amine as a base. Amines may be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. Flammable gaseous hydrogen is generated by amines in combination with strong reducing agents. |
| Packinggroup: | II |
| HS Code: | 29221980 |
| Storage Temperature: | Flammables area |
| Color: | COLORLESS LIQ |
| Usage: | Medication, catalyst. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
