| Identification | |
| Name: | 1-Nitropropane |
| Synonyms: | - |
| CAS: | 108-03-2 |
| EINECS: | 203-544-9 |
| Molecular Formula: | C3H7NO2 |
| Molecular Weight: | 89.09 |
| InChI: | InChI=1/C3H7NO2/c1-2-3-4(5)6/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2608 |
| Density: | 0.993 |
| Stability: | Stable. Flammable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.4005-1.4025 |
| Water Solubility: | 1.40 g/100 mL |
| Solubility: | Slightly soluble |
| Appearance: | Colorless liquid with a mild, fruity odor |
| Specification: | liquid Safety Statements:9 9:Keep container in a well-ventilated place |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29042000 |
| Storage Temperature: | Flammables area |
| Color: | TRANSPARENT LIQUID Colorless liquid |
| Usage: | Solvent for cellulose acetate, vinyl resins, lacquers, synthetic rubbers, fats, oils, dyes, other organic materials, as intermediate, propellant. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
