| Identification | |
| Name: | 2,4-dimethylpentane |
| Synonyms: | Dimethylpentane; 99%; Diisopropylmethane |
| CAS: | 108-08-7 |
| EINECS: | 203-548-0 |
| Molecular Formula: | C7H16 |
| Molecular Weight: | 100.20 |
| InChI: | InChI=1/C7H16/c1-6(2)5-7(3)4/h6-7H,5H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 3 |
| Density: | 79 |
| Refractive index: | n20/D 1.381(lit.) |
| Specification: | Safety Statements:9-16-29-33-60-61-62 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 29:Do not empty into drains 33:Take precautionary measures against static discharges 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
F: Flammable
Xn: Harmful
N: Dangerous for the environment
|
 |
|
