| Identification | ||
| Name: | 2-Pentanol, 4-methyl- | |
| Synonyms: | Methyl isobutyl carbinol; | |
| CAS: | 108-11-2 | |
| EINECS: | 210-790-0 | |
| Molecular Formula: | C6H14O | |
| Molecular Weight: | 0 | |
| InChI: | InChI=1/C6H14O/c1-5(2)4-6(3)7/h5-7H,4H2,1-3H3/t6-/m1/s1 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2282 3/PG 3 | |
| Stability: | Stable. Flammable. Incompatible with oxidizing agents, acids, acid chlorides. | |
| Refractive index: | n20/D 1.415(lit.) | |
| Water Solubility: | ||
| Solubility: | 20 g/L (20 C) | |
| Appearance: | A clear colorless liquid with a mild odor. | |
| Specification: | colourless liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes | |
| Packinggroup: | III | |
| HS Code: | 29051900 | |
| Storage Temperature: | Flammables area | |
| Color: | COLORLESS LIQ Colorless liquid. | |
| Usage: | Solvent for dyestuffs, oils, gums, resins, waxes, nitrocellulose, and ethylcellulose, organic synthesis, froth flotation, brake fluids. | |
| Safety Data | ||
 |
||
