| Identification | |
| Name: | Butanoyl chloride,3-methyl- |
| Synonyms: | Isovalerylchloride (6CI,7CI,8CI);3-Methylbutanoyl chloride;3-Methylbutyryl chloride;Isopentanoyl chloride;Isovaleric acid chloride;Isovaleric chloride;Isovaleroyl chloride; |
| CAS: | 108-12-3 |
| EINECS: | 203-552-2 |
| Molecular Formula: | C5H9ClO |
| Molecular Weight: | 120.58 |
| InChI: | InChI=1/C5H9ClO/c1-4(2)3-5(6)7/h4H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2502 8 |
| Density: | 0.98 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.415-1.417 |
| Water Solubility: | decomposes |
| Solubility: | decomposes |
| Appearance: | Colorless liquid. |
| Specification: | CLEAR COLOURLESS TO SLIGHTLY YELLOW OR PINK LIQUID Safety Statements:26-36/37/39-45-9-23-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 9:Keep container in a well-ventilated place 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
