| Identification | |
| Name: | 1-Dimethylamino-2-propanol |
| Synonyms: | N,N-Dimethylisopropanolamine |
| CAS: | 108-16-7 |
| EINECS: | 203-556-4 |
| Molecular Formula: | C5H13NO |
| Molecular Weight: | 103.16 |
| InChI: | InChI=1/C5H13NO/c1-5(7)4-6(2)3/h5,7H,4H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2734 |
| Density: | 0.837 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, amines, acids. |
| Refractive index: | 1.4183-1.4203 |
| Water Solubility: | miscible |
| Solubility: | miscible with water
SOLVENT
|
| Appearance: | clear to light yellow liquid |
| Specification: | light yellow liquid Safety Statements:26-36/37/39-45-36-23 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36:Wear suitable protective clothing 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29221980 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
