| Identification | |
| Name: | Protoanemonin |
| Synonyms: | 2,4-Pentadienoicacid, 4-hydroxy-, g-lactone (7CI);Protoanemonin (6CI);2,4-Pentadien-4-olide;4-Hydroxy-2,4-pentadienoic acid lactone;4-Hydroxy-2,4-pentadienoic acid g-lactone;5-Methylene-2(5H)-furanone;5-Methylene-2,5-dihydrofuran-2-one;5-Methylene-2-oxodihydrofuran;Isomycin;Protoanemonene;g-Methylenebutenolide; |
| CAS: | 108-28-1 |
| EINECS: | 203-567-4 |
| Molecular Formula: | C5H4O2 |
| Molecular Weight: | 96.08406 |
| InChI: | InChI=1/C5H4O2/c1-4-2-3-5(6)7-4/h2-3H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.14g/cm3 |
| Refractive index: | 1.492 |
| Specification: |
Protoanemonin , with CAS number is 108-28-1, can be called 2(5H)-furanone, 5-methylene- ; 4-Hydroxy-2,4-pentadienoic Acid g-Lactone ; 5-Methylene-2-oxodihydrofuran ; 5-methylidenefuran-2(5H)-one . |
| Safety Data | |
 |
|
