| Identification | |
| Name: | 1,3-Dibromobenzene |
| Synonyms: | m-Dibromobenzene |
| CAS: | 108-36-1 |
| EINECS: | 203-574-2 |
| Molecular Formula: | C6H4Br2 |
| Molecular Weight: | 235.9 |
| InChI: | InChI=1/C6H4Br2/c7-5-2-1-3-6(8)4-5/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2711 |
| Density: | 1.952 |
| Stability: | Stable under ordinary conditions of use and storage. |
| Refractive index: | 1.607-1.609 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Very faintly brown-yellow Clear liquid |
| Specification: | clear colourless to light yellow liquid Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
