| Identification | |
| Name: | 2,6-Dimethylpiperazine |
| Synonyms: | Dimethylpiperazine; 98%; cis-2,6-Dimethylpiperazine |
| CAS: | 108-49-6 |
| EINECS: | 203-588-9 |
| Molecular Formula: | C6H14N2 |
| Molecular Weight: | 114.19 |
| InChI: | InChI=1/C6H14N2/c1-5-3-7-4-6(2)8-5/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Flash Point: | 113? |
| Density: | 0.824g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | Ochre crystalline powder. |
| Specification: |
Piperazine, 2,6-dimethyl- , with CAS number of 108-49-6, can be called (2R,6S)-2,6-Dimethylpiperazine ; piperazine, 2,6-dimethyl-, (2R,6S)- ; Piperazine, 2,6-dimethyl-, cis- ; (2,6-cis-Dimethyl)piperazine . It is a white to pale yellow crystalline powder. |
| Packinggroup: | III |
| Flash Point: | 113? |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Flammables-area. |
| Sensitive: | Light Sensitive & Hygroscopic |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
