| Identification | |
| Name: | 4(1H)-Pyrimidinone,2-amino- |
| Synonyms: | Isocytosine(6CI,8CI);2-Amino-4-hydroxypyrimidine;2-Amino-4-pyrimidinol;2-Amino-4-pyrimidone;2-Aminopyrimidin-4(3H)-one;NSC 49118;2-Aminopyrimidin-4(1H)-one;2-Aminopyrimidin-4-ol;4-Hydroxy-2-aminopyrimidine; |
| CAS: | 108-53-2 |
| EINECS: | 203-592-0 |
| Molecular Formula: | C4H5N3O |
| Molecular Weight: | 111.1 |
| InChI: | InChI=1/C4H5N3O/c5-4-6-2-1-3(8)7-4/h1-2H,(H3,5,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 106.7 ºC |
| Boiling Point: | 252.7 ºC |
| Density: | 1.55 g/cm3 |
| Refractive index: | 1.688 |
| Appearance: | white to off-white solid |
| Specification: |
The chemical synonyms of 2-Amino-1h-pyrimidin-6-one (108-53-2) are 4-Hydroxy-2-aminopyrimidine ; 2-Amino-4-hydroxypyrimidine ; Isocytosine ; 2-Amino-6-hydroxpyrimidine ; 2-Amino-4-hydroxypyrimidine .The chemical of 2-Amino-1h-pyrimidin-6-one (108-53-2) is a useful intermediate for chemical modifications of base and sugar moieties in natural nucleosides.Personal protective equipment: Wear chemical splash goggles to protect Eyes, wear chemical splash goggles,wear appropriate protective gloves to prevent skin exposure and wear appropriate protective clothing to prevent skin. |
| Flash Point: | 106.7 ºC |
| Storage Temperature: | Room temperature. |
| Usage: | A useful intermediate for chemical modifications of base and sugar moieties in natural nucleosides |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
