| Identification | |
| Name: | Butanoicacid, 3-methyl-, ethyl ester |
| Synonyms: | Isovalericacid, ethyl ester (6CI,7CI,8CI);3-Methylbutanoic acid ethyl ester;3-Methylbutyric acid ethyl ester;Ethyl 3-methylbutanoate;Ethyl3-methylbutyrate;Ethyl isopentanoate;Isopentanoic acidethyl ester;NSC 8869; |
| CAS: | 108-64-5 |
| EINECS: | 203-602-3 |
| Molecular Formula: | C7H14O2 |
| Molecular Weight: | 130.19 |
| InChI: | InChI=1/C7H14O2/c1-4-9-7(8)5-6(2)3/h6H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 0.863 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.395-1.398 |
| Water Solubility: | soluble in propylene glycol, 1 ml in 350 ml water; miscible with alcohol, most fixed oils |
| Solubility: | soluble in propylene glycol, 1 ml in 350 ml water; miscible with alcohol, most fixed oils |
| Appearance: | colourless liquid/strong, fruity, vinous, apple-like odour on dilution |
| Specification: | clear colorless to pale yellowish liquid Safety Statements:16 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
