| Identification | |
| Name: | 1,3,5-Trichlorobenzene |
| Synonyms: | sym-Trichlorobenzene; TCB; Trichlorobenzene |
| CAS: | 108-70-3 |
| EINECS: | 203-608-6 |
| Molecular Formula: | C6H3Cl3 |
| Molecular Weight: | 181.45 |
| InChI: | InChI=1/C6H3Cl3/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3077 |
| Density: | 1.448 g/cm3 |
| Stability: | Stable. Incompatible with acids, strong oxidizing agents. |
| Refractive index: | 1.5662 (20 C) |
| Solubility: | Insoluble |
| Appearance: | White Crystal |
| Specification: | white to beige crystalline powder Safety Statements:26-36-36/37-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37:Wear suitable protective clothing and gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| Color: | Needles White crystals Long needles |
| Usage: | Component in trichlorobenzene mixt as dye solvent, degreasing solvent, dielectric fluid, & as lubricant additive. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
