| Identification | |
| Name: | Phloroglucinol |
| Synonyms: | 1,3,5-Benzenetriol; 1,3,5-THB; 1,3,5-Trihydroxybenzene; Phloroglucine; Phloroglucin; 1,3,5-trihydroxy benzene; Phloroglucinol Anhydrous |
| CAS: | 108-73-6 |
| EINECS: | 203-611-2 |
| Molecular Formula: | C6H6O3 |
| Molecular Weight: | 126.11 |
| InChI: | InChI=1/C6H6O3/c7-4-1-5(8)3-6(9)2-4/h1-3,7-9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.488g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.365 |
| Solubility: | 10 g/L |
| Appearance: | white to light yellow crystal |
| Specification: |
?Phloroglucinol , with CAS number of 108-73-6, can be called 5-Oxyresorcinolphloroglucin ; 1,3,5-Trihydroxycyclohexatriene ; Benzene, trihydroxy ; s-Trihydroxybenzene ; 4-06-00-07361 (Beilstein Handbook Reference) ; See also 1,3,5-Benzenetriol ; 1,3,5-Cyclohexanetrione ; 1,3,5-Trihydroxybenzene ; 1,3,5-Trihydroxybenzene anhydrate ; 1,3,5-trihydroxy benzene ; Phloroglucinol Dihydrate ; Phloroglucinol . It is a?white to light yellow crystal. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| HS Code: | 29072900 |
| Storage Temperature: | Dark Room |
| Sensitive: | Light Sensitive & Hygroscopic |
| Usage: | Substance is used in diazo-type printing, textile dyeing. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
