| Identification |
| Name: | 2(1H)-Pyrimidinone,4,6-dimethyl- |
| Synonyms: | 2(1H)-Pyrimidone,4,6-dimethyl- (1CI);2-Pyrimidinol, 4,6-dimethyl- (6CI);2-Hydroxy-4,6-dimethylpyrimidine;4,6-Dimethyl-1,2-dihydro-2-pyrimidone;4,6-Dimethyl-2(1H)-pyrimidinone;4,6-Dimethyl-2(1H)-pyrimidone;4,6-Dimethyl-2-pyrimidinol; |
| CAS: | 108-79-2 |
| EINECS: | 203-617-5 |
| Molecular Formula: | C6H8N2O |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C6H8N2O/c1-4-3-5(2)8-6(9)7-4/h3H,1-2H3,(H,7,8,9) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.17 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.497 |
| Appearance: | white needle-like crystal |
| Specification: |
1. Storage: Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances.
2. Handling: Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Use with adequate ventilation. Minimize dust generation and accumulation. Avoid contact with eyes, skin, and clothing. Keep container tightly closed. Avoid ingestion and inhalation.
3. Personal Protection: Eyes: Wear appropriate protective eyeglasses or chemical safety goggles as described by OSHA's eye and face protection regulations in 29 CFR 1910.133 or European Standard EN166. Skin: Wear appropriate protective gloves to prevent skin exposure. Clothing: Wear appropriate protective clothing to prevent skin exposure.
4. Fire Fighting: Wear a self-contained breathing apparatus in pressure-demand, MSHA/NIOSH (approved or equivalent), and full protective gear. During a fire, irritating and highly toxic gases may be generated by thermal decomposition or combustion. Extinguishing media: Use agent most appropriate to extinguish fire. In case of fire use water spray, dry chemical, carbon dioxide, or appropriate foam.
|
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
