| Identification | |
| Name: | 2,6-Dimethyl-4-heptanone |
| Synonyms: | Diisobutyl ketone~Isovalerone; Dimethylheptanone; 90%; Diisobutyl ketone; 2,6-Dimethyl-4-heptanone, remainder mainly 4,6-dimethyl-2-heptanone; 2,6-dimethylheptan-4-one; diisopropylacetone; isobutyl ketone; Isovalerone; Valerone; s-diisopropylacetone; sym-diisopropyl acetone; DiisobutylKetone |
| CAS: | 108-83-8 |
| EINECS: | 203-620-1 |
| Molecular Formula: | C9H18O |
| Molecular Weight: | 142.24 |
| InChI: | InChI=1/C9H18O/c1-7(2)5-9(10)6-8(3)4/h7-8H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1157 |
| Density: | 0.808 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.412-1.415 |
| Water Solubility: | 0.05 g/100 mL |
| Solubility: | 0.5 (g/l) |
| Appearance: | Clear liquid |
| Specification: | colourless liquid Safety Statements:24 24:Avoid contact with skin |
| Packinggroup: | III |
| HS Code: | 29141990 |
| Storage Temperature: | Flammables area |
| Color: | WATER CLEAR LIQUID Colorless oil Colorless liquid |
| Usage: | Solvent for nitrocellulose, for milled crepe rubber, vinylite, synthetic coatings and as a dispersant for organosol type resins, intermediate in synthesis of inhibitors, pharmaceuticals, dyes, & insecticides. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
