| Identification | |
| Name: | L-Tyrosine, methylester |
| Synonyms: | Tyrosine,methyl ester, L- (6CI,8CI);(S)-2-Amino-3-(4-hydroxyphenyl)propionic acidmethyl ester;Methyl (2S)-2-amino-3-(4-hydroxyphenyl)propionate;Methyl(2S)-3-(4-hydroxyphenyl)-2-aminopropionate;Methyltyrosinate;Tyrosine methyl ester;L-Tyrosine methyl ester;H-Tyr-OMe;L-Tyrosine, methyl ester;Methyl L-tyrosinate;Tyrosine, methyl ester, L-; |
| CAS: | 1080-06-4 |
| EINECS: | 214-095-3 |
| Molecular Formula: | C10H13NO3 |
| Molecular Weight: | 195.22 |
| InChI: | InChI=1/C10H13NO3/c1-14-10(13)9(11)6-7-2-4-8(12)5-3-7/h2-5,9,12H,6,11H2,1H3/t9-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.21 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Alpha: | 25 o (C=2.4, CH3OH) |
| Solubility: | Appearance:White to off-white crystalline powder Transport Information: OTH Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | White to off-white crystalline powder |
| Usage: | L-Tyrosine-induced antinociception is mediated by central .delta.-opioid receptors and by the bulbo-spinal noradrenergic system. |
| Safety Data | |
 |
|
