| Identification | |
| Name: | Butanamide,N-(4-ethoxyphenyl)-3-hydroxy- |
| CAS: | 1083-57-4 |
| EINECS: | 214-109-8 |
| Molecular Formula: | C12H17 N O3 |
| Molecular Weight: | 223.30 |
| InChI: | InChI=1/C12H17NO3/c1-3-16-11-6-4-10(5-7-11)13-12(15)8-9(2)14/h4-7,9,14H,3,8H2,1-2H3,(H,13,15) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 160 °C |
| Flash Point: | 216°C |
| Boiling Point: | 433.5°C at 760 mmHg |
| Density: | 1.151g/cm3 |
| Refractive index: | 1.558 |
| Specification: |
Bucetin , its cas register number is 1083-57-4. It also can be called 3-Hydroxy-p-butyrophenetidide ; Bucetinum ; beta-Oxybuttersaeure-p-phenetidid ; and 4'-Ethoxy-3-hydroxybutyranilide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 216°C |
| Safety Data | |
 |
|
