Identification |
Name: | Acetic acid,C8-10-branched alkyl esters, C9-rich |
Synonyms: | aceticacid,c8-10-branchedalkylesters,c9-rich;ACETIC ACID, ALKYL (C8 TO C10) ESTERS MIXTURE;Essigsure, C8-C10-verzweigte Alkylester, C9-reich;C8-10-alkyl acetates, branched, nonyl acetate-rich |
CAS: | 108419-33-6 |
Molecular Formula: | CH3CO2R,R=C9H19(primarily) |
Molecular Weight: | 0 |
InChI: | InChI=1/C11H22O2/c1-5-6-11(9(2)3)7-8-13-10(4)12/h9,11H,5-8H2,1-4H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 78.9°C |
Boiling Point: | 203.9°Cat760mmHg |
Density: | 0.869g/cm3 |
Refractive index: | n20/D 1.426(lit.) |
Flash Point: | 78.9°C |
Safety Data |
|
 |