Identification |
Name: | Ethanethioic acid,S-[3-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]propyl] ester |
Synonyms: | Aceticacid, thio-, S-ester with N-(3-mercaptopropoxy)phthalimide (7CI,8CI); NSC101750 |
CAS: | 1088-37-5 |
Molecular Formula: | C13H13 N O4 S |
Molecular Weight: | 279.3116 |
InChI: | InChI=1/C13H13NO4S/c1-9(15)19-8-4-7-18-14-12(16)10-5-2-3-6-11(10)13(14)17/h2-3,5-6H,4,7-8H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 215.1°C |
Boiling Point: | 432°Cat760mmHg |
Density: | 1.37g/cm3 |
Refractive index: | 1.615 |
Flash Point: | 215.1°C |
Safety Data |
|
 |