| Identification |
| Name: | Benzo[g]pteridine-2,4(3H,10H)-dione,7,8,10-trimethyl- |
| Synonyms: | Benzo[g]pteridin-2(10H)-one,4-hydroxy-7,8,10-trimethyl- (7CI); Lumiflavine (6CI,8CI); 7,8,10-Trimethylisoalloxazine;Lumiflavin; Lumilactoflavin |
| CAS: | 1088-56-8 |
| EINECS: | 214-125-5 |
| Molecular Formula: | C13H12 N4 O2 |
| Molecular Weight: | 256.26 |
| InChI: | InChI=1/C13H12N4O2/c1-6-4-8-9(5-7(6)2)17(3)11-10(14-8)12(18)16-13(19)15-11/h4-5H,1-3H3,(H,16,18,19) |
| Molecular Structure: |
![(C13H12N4O2) Benzo[g]pteridin-2(10H)-one,4-hydroxy-7,8,10-trimethyl- (7CI); Lumiflavine (6CI,8CI); 7,8,10-Trimeth...](https://img1.guidechem.com/chem/e/dict/48/1088-56-8.jpg) |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.47g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.728 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology No toxicological data available. Toxicity data (The meaning of any toxicological abbrevi |
| Solubility: | |
| Appearance: | deep yellow powder |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Safety Data |
| |
 |
