Identification |
Name: | Propanoic acid,2-methyl-, octyl ester |
Synonyms: | Isobutyricacid, octyl ester (6CI,7CI,8CI);Caprylyl isobutyrate;ENT 24265;NSC 72024;Octyl 2-methylpropanoate;Octyl isobutyrate;n-Octyl 2-methylpropanoate;n-Octyl isobutyrate; |
CAS: | 109-15-9 |
EINECS: | 203-651-0 |
Molecular Formula: | C12H24O2 |
Molecular Weight: | 200.3178 |
InChI: | InChI=1/C12H24O2/c1-4-5-6-7-8-9-10-14-12(13)11(2)3/h11H,4-10H2,1-3H3 |
Molecular Structure: |
|
Properties |
Density: | 0.869 g/cm3 |
Refractive index: | n20/D 1.421(lit.) |
Water Solubility: | colourless to pale yellow liquid/refreshing, herbaceous odour |
Solubility: | colourless to pale yellow liquid/refreshing, herbaceous odour |
Appearance: | colorless to pale yellow clear liquid |
Safety Data |
|
|