| Identification | |
| Name: | 10-Undecenoic acid,butyl ester |
| Synonyms: | Butyl10-undecenoate;Butyl 10-undecylenate;NSC 2395; |
| CAS: | 109-42-2 |
| EINECS: | 203-670-4 |
| Molecular Formula: | C15H28O2 |
| Molecular Weight: | 240.38 |
| InChI: | InChI=1/C15H28O2/c1-3-5-7-8-9-10-11-12-13-15(16)17-14-6-4-2/h3H,1,4-14H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 128 ºC |
| Boiling Point: | 301.7 ºC at 760 mmHg |
| Refractive index: | n20/D 1.4413(lit.) |
| Appearance: | colourless to pale yellow liquid |
| Specification: |
Butyl 10-Undecenoate (CAS NO.109-42-2) is a colorless to pale yellow clear liquid. To protect yourself, you can put on eyeshields, gloves . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 128 ºC |
| Safety Data | |
 |
|
