| Identification | |
| Name: | Hexanedioic acid,1,6-bis(2-ethoxyethyl) ester |
| Synonyms: | Adipicacid, bis(2-ethoxyethyl) ester (6CI,7CI,8CI); Hexanedioic acid,bis(2-ethoxyethyl) ester (9CI); Ethanol, 2-ethoxy-, adipate (2:1) (8CI);Bis(2-ethoxyethyl) adipate; Di(2-Ethoxyethyl)adipate; NSC 6796 |
| CAS: | 109-44-4 |
| EINECS: | 203-673-0 |
| Molecular Formula: | C14H26 O6 |
| Molecular Weight: | 290.40 |
| InChI: | InChI=1/C14H26O6/c1-3-17-9-11-19-13(15)7-5-6-8-14(16)20-12-10-18-4-2/h3-12H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >230 °F |
| Boiling Point: | 164-166 °C4 mm Hg(lit.) |
| Density: | 1.038 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.4410(lit.) |
| Specification: |
Bis(2-ethoxyethyl) adipate , its cas register number is 109-44-4. It also can be called 4-02-00-01968 (Beilstein Handbook Reference) ; AI3-00675 ; BRN 1799041 ; EINECS 203-673-0 ; NSC 6796 . When heated to decomposition it emits acrid smoke and irritating fumes. Bis(2-ethoxyethyl) adipate (CAS NO.109-44-4) is irritating to eyes, respiratory system and skin. In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. And wear suitable protective clothing when contacting with it. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | >230 °F |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
