| Identification |
| Name: | Thiourea, N,N'-dibutyl- |
| Synonyms: | Accel BUR-F;N,N'-Dibutylthiourea;1,3-Dibutylthiourea;NSC 3735;NSC 4148;Pennzone B;SancelerBUR;1,3-Dibutyl-2-thiourea;Urea,1,3-dibutyl-2-thio- (6CI,8CI);Thiate U;Stannine 5525; |
| CAS: | 109-46-6 |
| EINECS: | 203-674-6 |
| Molecular Formula: | C9H20N2S |
| Molecular Weight: | 188.33 |
| InChI: | InChI=1/C9H20N2S/c1-3-5-7-10-9(12)11-8-6-4-2/h3-8H2,1-2H3,(H2,10,11,12) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 186ºC |
| Boiling Point: | 122 °C / 14mmHg |
| Density: | 0.942g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.494 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | Clear to slightly yellow crystalline powder. |
| HS Code: | 29309070 |
| Flash Point: | 186ºC |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
