| Identification | |
| Name: | N-Valeric Acid |
| Synonyms: | 1-butanecarboxylic acid; Butanecarboxylic Acid; n-Pentanoic Acid; valerianic acid; VALERIC ACOD (N-PENTANOIC ACID); Valeric acid; propylacetic acid |
| CAS: | 109-52-4 |
| EINECS: | 203-677-2 |
| Molecular Formula: | C5H10O2 |
| Molecular Weight: | 102.13 |
| InChI: | InChI=1/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1760 |
| Density: | 0.939 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.407-1.41 |
| Solubility: | 10-50 mg/ml ( soluble in ethanol, ethyl ether) |
| Appearance: | Clear, pale beige liquid |
| Specification: | clear colorless to pale yellow liquid usageEng:Sex attractant of the sugar beet wireworm, Limonius californicus.1 Safety Statements:26-36-45-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | III |
| HS Code: | 29156090 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Color: | Colorless liquid |
| Usage: | Intermediate for flavors and perfumes, ester-type lubricants, plasticizers, pharmaceuticals, vinyl stabilizers. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
