| Identification | |
| Name: | Propyl chlorocarbonate |
| Synonyms: | Carbonochloridic acid propyl ester; chloroformic acid propyl ester; NORMAL PROPYL CHLOROFORMATE (NPCF); n-propyl chloroformate; Proply chloroformate; propyl chloroformate; |
| CAS: | 109-61-5 |
| EINECS: | 203-687-7 |
| Molecular Formula: | C4H7ClO2 |
| Molecular Weight: | 122.55 |
| InChI: | InChI=1/C4H7ClO2/c1-2-3-7-4(5)6/h2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2740 |
| Melting Point: | <-70ºC |
| Flash Point: | 84? |
| Density: | 1.09 |
| Refractive index: | 1.404 |
| Water Solubility: | react with water |
| Solubility: | react with water |
| Appearance: | colorless to light yellow transparent liquid |
| Specification: | Safety Statements:26-36-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
EPA Extremely Hazardous Substances List. Reported in EPA TSCA Inventory. |
| Packinggroup: | I |
| Flash Point: | 84? |
| Color: | COLORLESS LIQUID |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
