Identification |
Name: | Mercury, (acetato-kO)ethyl- |
Synonyms: | Ethylmercuryacetate (6CI); Mercury, (acetato)ethyl- (8CI); Mercury, (acetato-O)ethyl-;Mercury, acetoxyethyl- (7CI); Ethylmercuric acetate |
CAS: | 109-62-6 |
EINECS: | 203-688-2 |
Molecular Formula: | C4H8 Hg O2 |
Molecular Weight: | 288.71 |
InChI: | InChI=1/C2H4O2.C2H5.Hg/c1-2(3)4;1-2;/h1H3,(H,3,4);1H2,2H3;/q;;+1/p-1/rC2H5Hg.C2H4O2/c1-2-3;1-2(3)4/h2H2,1H3;1H3,(H,3,4)/q+1;/p-1 |
Molecular Structure: |
 |
Properties |
Transport: | 2025 |
Flash Point: | 40°C |
Boiling Point: | 117.1°Cat760mmHg |
Density: | g/cm3 |
Report: |
Mercury and its compounds are on the Community Right-To-Know List.
|
Packinggroup: | II |
Flash Point: | 40°C |
Safety Data |
Hazard Symbols |
|
|
 |