| Identification | |
| Name: | 2H-1-Benzopyran-3(4H)-one,5-methoxy- |
| Synonyms: | 5-Methoxy-2H-chromen-3(4H)-one;5-Methoxy-3-chromanone; |
| CAS: | 109140-20-7 |
| Molecular Formula: | C10H10O3 |
| Molecular Weight: | 178.1846 |
| InChI: | InChI=1/C10H10O3/c1-12-9-3-2-4-10-8(9)5-7(11)6-13-10/h2-4H,5-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.206 g/cm3 |
| Refractive index: | 1.547 |
| Specification: |
The cas register number of 5-Methoxy-3-chromanone is 109140-20-7. The Systematic name about this chemical is 5-Methoxy-2H-chromen-3(4H)-one. Physical properties about 5-Methoxy-3-chromanone are: (1)ACD/LogP: 2.28; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 35.53Å2; (7)Index of Refraction: 1.547; (8)Molar Refractivity: 46.841 cm3; (9)Molar Volume: 147.806 cm3; (10)Surface Tension: 42.167 dyne/cm; (11)Density: 1.206 g/cm3; (12)Flash Point: 145.916 °C; (13)Enthalpy of Vaporization: 57.512 kJ/mol; (14)Boiling Point: 332.36 °C at 760 mmHg; (15)Vapour Pressure: 0 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
