| Identification | |
| Name: | trans-3-Ethoxycarbonyl-4-(4-flurophenyl)-N-methyl piperdine-2,6-dione |
| Synonyms: | 3-piperidinecarboxylic acid, 4-(4-fluorophenyl)-1-methyl-2,6-dioxo-, ethyl ester, (3R,4S)-;3-Piperidinecarboxylic acid, 4-(4-fluorophenyl)-1-methyl-2,6-dioxo-, ethylester, trans-; |
| CAS: | 109887-52-7 |
| Molecular Formula: | C15H16FNO4 |
| Molecular Weight: | 293.29 |
| InChI: | InChI=1/C15H16FNO4/c1-3-21-15(20)13-11(8-12(18)17(2)14(13)19)9-4-6-10(16)7-5-9/h4-7,11,13H,3,8H2,1-2H3/t11-,13-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.258g/cm3 |
| Refractive index: | 1.526 |
| Specification: |
trans-3-Ethoxycarbonyl-4-(4-flurophenyl)-N-methyl piperdine-2,6-dione , with CAS number of 109887-52-7, can be called 3-Piperidinecarboxylic acid, 4-(4-fluorophenyl)-1-methyl-2,6-dioxo-, ethylester, trans- ; 3-piperidinecarboxylic acid, 4-(4-fluorophenyl)-1-methyl-2,6-dioxo-, ethyl ester, (3R,4S)- . |
| Safety Data | |
 |
|
