| Identification | |
| Name: | Acetonylacetone |
| Synonyms: | 2,5-Hexanedione; Hexan-2,5-Dion |
| CAS: | 110-13-4 |
| EINECS: | 203-738-3 |
| Molecular Formula: | C6H10O2 |
| Molecular Weight: | 114.14 |
| InChI: | InChI=1/C6H10O2/c1-5(7)3-4-6(2)8/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.973 |
| Stability: | Stable. Incompatible with strong bases, strong reducing agents, strong oxidizing agents. Flammable. |
| Refractive index: | 1.425-1.427 |
| Water Solubility: | miscible |
| Solubility: | miscible |
| Appearance: | clear slight brown liquid |
| Specification: |
?2,5-Hexanedione (110-13-4) is a clear colorless to amber liquid with a sweet aromatic odor. It is is stable and mainly used as a synthetic resin, nitro-painting, coloring agents, printing ink and other high-boiling point solvents. It is incompatible with oxidizing agents and also incompatible with strong bases and strong reducing agents. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29141990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a cool, dry place. Keep container closed when not in use. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
