| Identification | |
| Name: | Fumaric acid |
| Synonyms: | trans-2-Butenedioic acid |
| CAS: | 110-17-8 |
| EINECS: | 203-743-0 |
| Molecular Formula: | C4H4O4 |
| Molecular Weight: | 116.07 |
| InChI: | InChI=1/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 9126 |
| Density: | 1.625 |
| Stability: | Stable at room temperature. Decomposes at around 230 C. Incompatible with strong oxidizing agents, bases, reducing agents. Combustible. |
| Solubility: | 0.63 g/100 mL (25 oC) |
| Appearance: | white powder or colourless crystals |
| Specification: |
?Fumaric acid ,?its cas register number is?110-17-8. It also can be called?1,2-Ethenedicarboxylic acid, trans- ; 1,2-Ethylenedicarboxylic acid, (E) ; 2-Butenedioic acid, (E)- ; Allomaleic acid ; Allomalenic acid ; Butenedioic acid, (E)- ; Kyselina fumarova ; Lichenic acid ; Tumaric acid ; trans-1,2-Ethylenedicarboxylic acid ; |
| Packinggroup: | Z01 |
| Color: | Needles, monoclinic prisms or leaflets from water Colorless crystals WHITE CRYSTALLINE POWDER |
| Usage: | Occurs in many plants. Essential to vegetable and tissue respiration. Used as an antioxidant. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
