| Identification | |
| Name: | Peroxide, diacetyl |
| Synonyms: | Acetylperoxide (8CI); Diacetylperoxide; NSC 669; Peroyl A |
| CAS: | 110-22-5 |
| EINECS: | 203-748-8 |
| Molecular Formula: | C4H6 O4 |
| Molecular Weight: | 118.04 |
| InChI: | InChI=1/C4H6O4/c1-3(5)7-8-4(2)6/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3115 |
| Melting Point: | 30 C |
| Flash Point: | 32.2°C |
| Boiling Point: | 121.4°Cat760mmHg |
| Density: | 1.163g/cm3 |
| Stability: | Stability Explosive. May explode if heated, or in contact with combustible materials. The pure material should not be handled by untrained persons. Unstable as the pure material. Incompatible with organic materials. |
| Refractive index: | 1.391 |
| Water Solubility: | slight |
| Solubility: | slight |
| Appearance: | colourless liquid with a pungent odour. Generally stored as a 25% solution in dimethyl phthalate toprevent detonation. |
| Specification: | colourless liquid with a pungent odour. |
| Packinggroup: | II |
| Flash Point: | 32.2°C |
| Color: | Colorless crystals NEEDLES FROM ETHER, LEAVES |
| Safety Data | |
 |
|
