| Identification | |
| Name: | Tetradecanoic acid,butyl ester |
| Synonyms: | Myristicacid, butyl ester (6CI,7CI,8CI); Butyl myristate; Butyl tetradecanoate;Crodamol BM; NSC 4814 |
| CAS: | 110-36-1 |
| EINECS: | 203-759-8 |
| Molecular Formula: | C18H36 O2 |
| Molecular Weight: | 284.54 |
| InChI: | InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 158.5°C |
| Boiling Point: | 334.7°Cat760mmHg |
| Density: | 0.864g/cm3 |
| Refractive index: | 1.442 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 158.5°C |
| Safety Data | |
 |
|
