| Identification | |
| Name: | Phenol,5-amino-4-chloro-2-methyl- |
| Synonyms: | 2-Methyl-4-chloro-5-aminophenol;2-Methyl-5-amino-4-chlorophenol;3-Amino-4-chloro-6-methylphenol;4-Chloro-5-amino-2-methylphenol;5-Amino-4-chloro-2-methylphenol; |
| CAS: | 110102-86-8 |
| Molecular Formula: | C7H8ClNO |
| Molecular Weight: | 157.60 |
| InChI: | InChI=1/C7H8ClNO/c1-4-2-5(8)6(9)3-7(4)10/h2-3,10H,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 128 ºC |
| Boiling Point: | 289 ºC |
| Density: | 1.331 |
| Refractive index: | 1.63 |
| Specification: |
The 5-Amino-4-chloro-2-methylphenol with the CAS number 110102-86-8 is also called Phenol,5-amino-4-chloro-2-methyl-. Its molecular formula is C7H8ClNO. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.99; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 3; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 46.25 Å2; (7)Index of Refraction: 1.63; (8)Molar Refractivity: 42.091 cm3; (9)Molar Volume: 118.369 cm3; (10)Polarizability: 16.686×10-24cm3; (11)Surface Tension: 54.512 dyne/cm; (12)Enthalpy of Vaporization: 54.928 kJ/mol; (13)Vapour Pressure: 0.001 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 128 ºC |
| Safety Data | |
 |
|
