| Identification | |
| Name: | (2S,6R)-6-Amino-2-(2-thienyl)-1,4-thiazepan-5-one |
| Synonyms: | 1,4-Thiazepin-5(2H)-one,6-aminotetrahydro-2-(2-thienyl)-, (2S-trans)- (9CI);(2S,6R)-6-Amino-5-oxo-2-(2-thienyl)perhydro-1,4-thiazepine;1,4-Thiazepin-5(2H)-one,6-aminotetrahydro-2-(2-thienyl)-, (2S,6R)-;(2S,6R)-6-amino-2-(thiophen-2-yl)-1,4-thiazepan-5-one; |
| CAS: | 110221-26-6 |
| Molecular Formula: | C9H12N2OS2 |
| Molecular Weight: | 228.34 |
| InChI: | InChI=1/C9H12N2OS2/c10-6-5-14-8(4-11-9(6)12)7-2-1-3-13-7/h1-3,6,8H,4-5,10H2,(H,11,12)/t6-,8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 163-1650C |
| Flash Point: | 251.8°C |
| Boiling Point: | 492.8°C at 760 mmHg |
| Density: | 1.286 |
| Refractive index: | 1.604 |
| Appearance: | white crystalline powder |
| Specification: |
(2S,6R)-6-Amino-2-(2-thienyl)-1,4-thiazepan-5-one , its cas register number 110221-26-6. It also can be called (2S,6R)-6-Amino-2-(2-thienyl)-1,4-thiazepan-5-on ; (2S,6R)-6-Amino-2-(thiophen-2-yl)-1,4-thiazepan-5-on ; (2S,6R)-6-amino-2-(thiophen-2-yl)-1,4-thiazepan-5-one ; 1,4-thiazepin-5(2H)-one, 6-aminotetrahydro-2-(2-thienyl)-, (2S,6R)- ; and (2S,6R)-6-Amino-5-oxo-2-(2-thienyl)perhydro-1,4-thiazepine . |
| Flash Point: | 251.8°C |
| Usage: |
(2S,6R)-6-Amino-2-(2-thienyl)-1,4-thiazepan-5-one (CAS NO.110221-26-6) is a key intermediate used in the preparation of temocapril. It also can be used as Temocapril intermediate. |
| Safety Data | |
 |
|
