| Identification | |
| Name: | Propanamide,N-(3,4-dichlorophenyl)- |
| Synonyms: | Propionanilide,3',4'-dichloro- (6CI,8CI); 3',4'-Dichloropropionanilide; Chem Rice; DCPA; DPA;FW 734; N-(3,4-Dichlorophenyl)propionamide; NSC 31312; Propagrin 36; Propanex;Propanid; Propanide; Propanil; Propasint; Propionic acid 3,4-dichloroanilide;Riverside propanil 60DF; Rogue; Stam; Stam 80EDF; Stam F 34; Stam LV 10; Stam M4; Stam Novel Flo 480; Stampede 360; Strel; Surcopur; Synpran N; Wham EZ |
| CAS: | 110343-36-7 |
| Molecular Formula: | C9H9 Cl2 N O |
| Molecular Weight: | 218.0799 |
| InChI: | InChI=1S/C9H9Cl2NO/c1-2-9(13)12-6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 91-93 deg C |
| Flash Point: | 177.5°C |
| Boiling Point: | 369.9°Cat760mmHg |
| Density: | 1.338g/cm3 |
| Solubility: | Solubility in water at room temperature: 225 ppm In water 130 mg/L at 20 deg C; in isopropanol and dichloromethane >200 g/L at 20 deg C, toluene 50-100 g/L at 20 deg C, and hexane Sparingly soluble in aromatic solvents In water, 152 mg/L at 25 deg C |
| Flash Point: | 177.5°C |
| Color: | White crystalline solid /Purity not provided/ Colorless crystals /Purity not provided/ Light brown solid (pure) Dark oily liquid Solid, white-gray |
| Safety Data | |
 |
|
