Identification |
Name: | 1H-Pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione,4-ethyl-4-hydroxy-, (4R)- |
Synonyms: | 1H-Pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione,4-ethyl-4-hydroxy-, (R)-; (R)-(-)-Camptothecin; (R)-(-)-Camptothecine;(R)-Camptothecin; 20R-Camptothecin |
CAS: | 110351-92-3 |
Molecular Formula: | C20H16 N2 O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C20H16N2O4/c1-2-20(25)14-8-16-17-12(7-11-5-3-4-6-15(11)21-17)9-22(16)18(23)13(14)10-26-19(20)24/h3-8,25H,2,9-10H2,1H3/t20-/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 411.6°C |
Boiling Point: | 757°Cat760mmHg |
Density: | 1.51g/cm3 |
Refractive index: | 1.746 |
Flash Point: | 411.6°C |
Usage: | Antitumor alkaloid. Binds irreversible to the DNA-topoisomerase I complex, inhibiting the reassociation of DNA after cleavage by topoisomerase I and traps the enzyme in a covalent linkage with DNA. A cytotoxic antitumor agent |
Safety Data |
|
|