| Identification | |
| Name: | Isooctene (7CI,8CI,9CI) |
| Synonyms: | 6-Methyl-1-heptene; |
| CAS: | 11071-47-9 |
| EINECS: | 234-294-9 |
| Molecular Formula: | C8H16 |
| Molecular Weight: | 112.2126 |
| InChI: | InChI=1S/C8H16/c1-4-5-6-7-8(2)3/h4,8H,1,5-7H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2050 3 |
| Density: | 0.719 g/cm3 |
| Refractive index: | n20/D 1.411 |
| Appearance: | clear colorless liquid |
| Specification: |
2,4,4-Trimethyl Pentene (CAS NO.11071-47-9) is a clear colorless liquid with a petroleum-like odor. It less dense than water and insoluble in water. Its vapors are lighter than air.It may react vigorously with strong oxidizing agents and may react exothermically with reducing agents to release hydrogen gas. Inhalation or contact with material may irritate or burn skin and eyes. Fire may produce irritating, corrosive and/or toxic gases. Vapors may cause dizziness or suffocation. Runoff from fire control or dilution water may cause pollution. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
F: Flammable
N: Dangerous for the environment
|
 |
|
