Identification |
Name: | Tetracosane,2,6,10,15,19,23-hexamethyl- |
Synonyms: | Dodecahydrosqualene;Fitoderm;Mild Finish 20P;NSC 6851;Nikko Squalane;Perhydrosqualene;Phtyosqualan;Phytiane LS;Phytosqualan;Pripure 3759;Pripure 379;Pripure SQV 3759;Robane;SQ-CONO;SophimSqualane-S;Spinacane;Squalan;Squalane;Squalane N;Super Squalane;Vitabiosol;2,6,10,15,19,23-Hexamethyltetracosane;Cetiol SQ;Cosbiol; |
CAS: | 111-01-3 |
EINECS: | 203-825-6 |
Molecular Formula: | C30H62 |
Molecular Weight: | 422.81 |
InChI: | InChI=1/C30H62/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h25-30H,9-24H2,1-8H3 |
Molecular Structure: |
|
Properties |
Density: | 0.8085 |
Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
Refractive index: | 1.451-1.4525 |
Appearance: | viscous colourless liquid |
Specification: | viscous colourless liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|