| Identification | |
| Name: | 2-octanone(Methyl Hexyl Ketone) |
| Synonyms: | n-Hexyl methyl ketone; Methyl hexyl ketone; SEC-OCTANONE; OCTANONE,2-; MHK; FEMA 2802; HEXYL METHYL KETONE; METHYL N-HEXYL KETONE |
| CAS: | 111-13-7 |
| EINECS: | 203-837-1 |
| Molecular Formula: | C8H16O |
| Molecular Weight: | 128.21 |
| InChI: | InChI=1/C8H16O/c1-3-4-5-6-7-8(2)9/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 |
| Density: | 0.819 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Flammable. |
| Refractive index: | 1.414-1.416 |
| Water Solubility: | 0.9 g/L |
| Solubility: | 0.9 g/L |
| Appearance: | colorless liquid |
| Specification: |
2-Octanone , its cas register number is 111-13-7. It also can be called Hexyl methyl ketone ; Methyl hexyl ketone ; Methyl n-hexyl ketone ; UNII-J2G84H29AF ; n-Hexyl methyl ketone . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29141990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Colorless liquid |
| Usage: | Biological stain. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
